churchillvanessam churchillvanessam

03-10-2020
Chemistry

contestada

For NH4NO3(s) write a balanced thermochemical equation.

Respuesta :

sagarsaud666 sagarsaud666

03-10-2020

Answer:

step1

NH4NO3(s)+H2O(I)--------->NH⁴OH(aq)+HNO³(aq)

step²

NH⁴OH(aq)+HNO³(aq)-------->NH⁴+(aq)+NO³-(aq)+H²O(I)

Answer Link

Otras preguntas

A large pot holds 8 quarts of spaghetti sauce.Lisa has 1-pint containers of spaghetti sauce.

What is the resultant of a+b? 3, 3 9, 3 6, 6 7, 5

What type of glacier forms in a montainous area?

Why did the France start a colony in canada

A projectile is thrown upward so that its distance above the ground after t seconds is given by the function h(t) = -16t2 + 576t. After how many seconds does th

A 6-year-old child ate a peanut butter sandwich at snack time in school. five minutes later, her throat became swollen and she collapsed. this allergic reaction

To what does the poet compare farming in “A Black Man Talks of Reaping”? A. making clothing and household goods B. the work of African Americans C. s

Which of the following is true of Tenochtitlan, the center of the Aztec culture? It was built in the middle of a lake and had many canals. It was located in a r

Jade had the following system of equations to help her with a physics problem, but she only needed to know what the sum of x and y is. 2x+3y=12 2x-y=4 What is

90 divided by -7.2 (I want to see how do you do it